C17H23F6N3O5S — CID 155826447
(3aS,7R,7aR)-N,N-dimethyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155826447) has the molecular formula C17H23F6N3O5S and a molecular weight of 495.44 g/mol. Its IUPAC name is (3aS,7R,7aR)-N,N-dimethyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,7R,7aR)-N,N-dimethyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155826447 |
| Molecular Formula | C17H23F6N3O5S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (3aS,7R,7aR)-N,N-dimethyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)[C@H]1COC[C@@H]2CN(Cc3nccs3)C[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H21N3OS.2C2HF3O2/c1-15(2)12-9-17-8-10-5-16(6-11(10)12)7-13-14-3-4-18-13;2*3-2(4,5)1(6)7/h3-4,10-12H,5-9H2,1-2H3;2*(H,6,7)/t10-,11-,12-;;/m0../s1 |
| InChIKey | MJEJOSZXPUTFHL-MGKSKXMVSA-N |
| XLogP | 2.42 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |