C19H27F6N5O6 — CID 155826613
3-[(3R,3aR,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155826613) has the molecular formula C19H27F6N5O6 and a molecular weight of 535.44 g/mol. Its IUPAC name is 3-[(3R,3aR,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[(3R,3aR,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155826613 |
| Molecular Formula | C19H27F6N5O6 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 3-[(3R,3aR,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)N[C@@H]1CN(Cc2cnn(C)c2)[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O2.2C2HF3O2/c1-18(2)15(21)17-12-10-20(9-11-7-16-19(3)8-11)13-5-4-6-22-14(12)13;2*3-2(4,5)1(6)7/h7-8,12-14H,4-6,9-10H2,1-3H3,(H,17,21);2*(H,6,7)/t12-,13-,14-;;/m1../s1 |
| InChIKey | FCDYEWJBAFCAOD-HYIPHPLDSA-N |
| XLogP | 1.69 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |