C16H24F3N3O4 — CID 155826614
6-(oxan-4-ylmethoxymethyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 155826614) has the molecular formula C16H24F3N3O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 6-(oxan-4-ylmethoxymethyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(oxan-4-ylmethoxymethyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826614 |
| Molecular Formula | C16H24F3N3O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 6-(oxan-4-ylmethoxymethyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ncn2c1CNCC(COCC1CCOCC1)C2 |
| InChI | InChI=1S/C14H23N3O2.C2HF3O2/c1-3-18-4-2-12(1)9-19-10-13-5-15-6-14-7-16-11-17(14)8-13;3-2(4,5)1(6)7/h7,11-13,15H,1-6,8-10H2;(H,6,7) |
| InChIKey | DWKIDAPOOSXPPB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |