C18H28F3N3O5 — CID 155826717
4-[[(2S,3S)-3-(2-methoxyethoxy)-1-(oxolan-3-yl)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid (PubChem CID 155826717) has the molecular formula C18H28F3N3O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is 4-[[(2S,3S)-3-(2-methoxyethoxy)-1-(oxolan-3-yl)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(2S,3S)-3-(2-methoxyethoxy)-1-(oxolan-3-yl)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826717 |
| Molecular Formula | C18H28F3N3O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-[[(2S,3S)-3-(2-methoxyethoxy)-1-(oxolan-3-yl)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid |
| SMILES | COCCO[C@H]1CCN(C2CCOC2)[C@H]1Cc1cnn(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H27N3O3.C2HF3O2/c1-18-11-13(10-17-18)9-15-16(22-8-7-20-2)3-5-19(15)14-4-6-21-12-14;3-2(4,5)1(6)7/h10-11,14-16H,3-9,12H2,1-2H3;(H,6,7)/t14?,15-,16-;/m0./s1 |
| InChIKey | QYVAYQCYJKHCOY-CTIJFNHYSA-N |
| XLogP | 1.49 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|