C20H21F4N3O3S — CID 155826797
(3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155826797) has the molecular formula C20H21F4N3O3S and a molecular weight of 459.47 g/mol. Its IUPAC name is (3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826797 |
| Molecular Formula | C20H21F4N3O3S |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)C[C@H]3[C@H]2CCN3Cc2cccc(F)c2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20FN3OS.C2HF3O2/c1-12-20-15(11-24-12)10-22-16-5-6-21(17(16)8-18(22)23)9-13-3-2-4-14(19)7-13;3-2(4,5)1(6)7/h2-4,7,11,16-17H,5-6,8-10H2,1H3;(H,6,7)/t16-,17+;/m1./s1 |
| InChIKey | RMCGQSRHUMQZBH-PPPUBMIESA-N |
| XLogP | 3.60 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |