C19H27F3N4O4 — CID 155826924
N-[[(3S,3aR,7aR)-5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826924) has the molecular formula C19H27F3N4O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is N-[[(3S,3aR,7aR)-5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aR,7aR)-5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826924 |
| Molecular Formula | C19H27F3N4O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[[(3S,3aR,7aR)-5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(C(=O)NC[C@H]2OC[C@@H]3CCN(CC4CC4)C[C@@H]32)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O2.C2HF3O2/c1-20-9-14(6-19-20)17(22)18-7-16-15-10-21(8-12-2-3-12)5-4-13(15)11-23-16;3-2(4,5)1(6)7/h6,9,12-13,15-16H,2-5,7-8,10-11H2,1H3,(H,18,22);(H,6,7)/t13-,15-,16+;/m0./s1 |
| InChIKey | YWVGKCZOKVKECP-BDUBYZFESA-N |
| XLogP | 1.53 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |