C14H22F3N3O4 — CID 155826950
4-[[(2S,3R)-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid (PubChem CID 155826950) has the molecular formula C14H22F3N3O4 and a molecular weight of 353.34 g/mol. Its IUPAC name is 4-[[(2S,3R)-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826950 |
| Molecular Formula | C14H22F3N3O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole;2,2,2-trifluoroacetic acid |
| SMILES | COCCO[C@@H]1CCN[C@H]1Cc1cnn(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H21N3O2.C2HF3O2/c1-15-9-10(8-14-15)7-11-12(3-4-13-11)17-6-5-16-2;3-2(4,5)1(6)7/h8-9,11-13H,3-7H2,1-2H3;(H,6,7)/t11-,12+;/m0./s1 |
| InChIKey | LEDKVIKFARCNSP-ZVWHLABXSA-N |
| XLogP | 0.99 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|