About 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one
3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one (PubChem CID 15582700) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one.
Molecular Properties
| Compound Name | 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one |
| PubChem CID | 15582700 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one |
| SMILES | Cc1nnc(CC(=O)C(C)C)o1 |
| InChI | InChI=1S/C8H12N2O2/c1-5(2)7(11)4-8-10-9-6(3)12-8/h5H,4H2,1-3H3 |
| InChIKey | XYVONIOMDJQDKL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one?
The IUPAC name of 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one (CID 15582700) is 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one.
What is the SMILES notation for 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one?
The canonical SMILES for 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one is Cc1nnc(CC(=O)C(C)C)o1.
What is the InChIKey of 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one?
The InChIKey is XYVONIOMDJQDKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5(2)7(11)4-8-10-9-6(3)12-8/h5H,4H2,1-3H3.
What are the key properties of 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one?
3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one has a molecular weight of 168.20 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)butan-2-one is sourced from PubChem (CID 15582700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).