C17H22F4N4O3 — CID 155827155
(7R,8aS)-7-(cyclopropylmethoxy)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid (PubChem CID 155827155) has the molecular formula C17H22F4N4O3 and a molecular weight of 406.38 g/mol. Its IUPAC name is (7R,8aS)-7-(cyclopropylmethoxy)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid.
| Compound Name | (7R,8aS)-7-(cyclopropylmethoxy)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827155 |
| Molecular Formula | C17H22F4N4O3 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (7R,8aS)-7-(cyclopropylmethoxy)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1cnc(N2CCN3C[C@H](OCC4CC4)C[C@H]3C2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21FN4O.C2HF3O2/c16-12-6-17-15(18-7-12)20-4-3-19-9-14(5-13(19)8-20)21-10-11-1-2-11;3-2(4,5)1(6)7/h6-7,11,13-14H,1-5,8-10H2;(H,6,7)/t13-,14+;/m0./s1 |
| InChIKey | CKTZKQGNQULZIL-LMRHVHIWSA-N |
| XLogP | 1.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |