C22H25F6N5O6 — CID 155827161
(3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827161) has the molecular formula C22H25F6N5O6 and a molecular weight of 569.46 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827161 |
| Molecular Formula | C22H25F6N5O6 |
| Molecular Weight | 569.46 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | (3R,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-N-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2C[C@@H]3[C@@H](C(=O)NCc4ccccn4)CO[C@@H]3C2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N5O2.2C2HF3O2/c1-22-8-13(6-21-22)9-23-10-15-16(12-25-17(15)11-23)18(24)20-7-14-4-2-3-5-19-14;2*3-2(4,5)1(6)7/h2-6,8,15-17H,7,9-12H2,1H3,(H,20,24);2*(H,6,7)/t15-,16+,17-;;/m1../s1 |
| InChIKey | SXERYHRRSZNFTQ-VVEZYYRQSA-N |
| XLogP | 1.84 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |