C27H24F6N2O6S — CID 155827448
2-[(3-methylphenyl)methyl]-7-pyridin-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827448) has the molecular formula C27H24F6N2O6S and a molecular weight of 618.55 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-7-pyridin-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3-methylphenyl)methyl]-7-pyridin-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827448 |
| Molecular Formula | C27H24F6N2O6S |
| Molecular Weight | 618.55 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-7-pyridin-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cccc(CN2CC3c4cc(-c5cccnc5)ccc4S(=O)(=O)C3C2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H22N2O2S.2C2HF3O2/c1-16-4-2-5-17(10-16)13-25-14-21-20-11-18(19-6-3-9-24-12-19)7-8-22(20)28(26,27)23(21)15-25;2*3-2(4,5)1(6)7/h2-12,21,23H,13-15H2,1H3;2*(H,6,7) |
| InChIKey | OYMXDEUCYZBZRJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |