C19H27F3N4O6 — CID 155827454
[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-(oxan-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155827454) has the molecular formula C19H27F3N4O6 and a molecular weight of 464.44 g/mol. Its IUPAC name is [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-(oxan-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-(oxan-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827454 |
| Molecular Formula | C19H27F3N4O6 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-(oxan-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCNc1ccnc(C2COCCN2C(=O)C2CCOCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O4.C2HF3O2/c1-23-10-6-18-15-2-5-19-16(20-15)14-12-25-11-7-21(14)17(22)13-3-8-24-9-4-13;3-2(4,5)1(6)7/h2,5,13-14H,3-4,6-12H2,1H3,(H,18,19,20);(H,6,7) |
| InChIKey | OFGGMEMQXIEXTL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|