C21H27F3N4O3 — CID 155827476
[7-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(4-ethylphenyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155827476) has the molecular formula C21H27F3N4O3 and a molecular weight of 440.47 g/mol. Its IUPAC name is [7-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(4-ethylphenyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [7-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(4-ethylphenyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827476 |
| Molecular Formula | C21H27F3N4O3 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [7-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(4-ethylphenyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(C(=O)N2Cc3ccnn3CC(CN(C)C)C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4O.C2HF3O2/c1-4-15-5-7-17(8-6-15)19(24)22-12-16(11-21(2)3)13-23-18(14-22)9-10-20-23;3-2(4,5)1(6)7/h5-10,16H,4,11-14H2,1-3H3;(H,6,7) |
| InChIKey | ISBPAORCJJUZQG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |