C21H26F9N3O6S — CID 155827571
4-[[1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-2-methyl-1,3-thiazole;tris(2,2,2-trifluoroacetic acid) (PubChem CID 155827571) has the molecular formula C21H26F9N3O6S and a molecular weight of 619.50 g/mol. Its IUPAC name is 4-[[1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-2-methyl-1,3-thiazole;tris(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-2-methyl-1,3-thiazole;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827571 |
| Molecular Formula | C21H26F9N3O6S |
| Molecular Weight | 619.50 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | 4-[[1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-2-methyl-1,3-thiazole;tris(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCC3C2CCN3CC2CC2)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3S.3C2HF3O2/c1-11-16-13(10-19-11)9-18-7-5-14-15(18)4-6-17(14)8-12-2-3-12;3*3-2(4,5)1(6)7/h10,12,14-15H,2-9H2,1H3;3*(H,6,7) |
| InChIKey | GXMOAXOIAYSAPW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |