C15H21F3N2O5S2 — CID 155827616
N-[(3R,3aS,7aR)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155827616) has the molecular formula C15H21F3N2O5S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[(3R,3aS,7aR)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3R,3aS,7aR)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827616 |
| Molecular Formula | C15H21F3N2O5S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[(3R,3aS,7aR)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N[C@@H]1CN(Cc2ccsc2)[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N2O3S2.C2HF3O2/c1-20(16,17)14-11-8-15(7-10-4-6-19-9-10)12-3-2-5-18-13(11)12;3-2(4,5)1(6)7/h4,6,9,11-14H,2-3,5,7-8H2,1H3;(H,6,7)/t11-,12-,13-;/m1./s1 |
| InChIKey | JRYGRBGQIHDMBA-NLPVPVDASA-N |
| XLogP | 1.66 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |