C24H27F3N2O5 — CID 155827653
[8-[2-(cyclopropylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155827653) has the molecular formula C24H27F3N2O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is [8-[2-(cyclopropylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [8-[2-(cyclopropylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827653 |
| Molecular Formula | C24H27F3N2O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [8-[2-(cyclopropylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccnc2ccccc12)N1CC2(C1)OCCC2CCOCC1CC1 |
| InChI | InChI=1S/C22H26N2O3.C2HF3O2/c25-21(19-7-10-23-20-4-2-1-3-18(19)20)24-14-22(15-24)17(9-12-27-22)8-11-26-13-16-5-6-16;3-2(4,5)1(6)7/h1-4,7,10,16-17H,5-6,8-9,11-15H2;(H,6,7) |
| InChIKey | NCYNNGZFGHUUOA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|