C15H20F3N5O4S2 — CID 155827744
N-[2-[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155827744) has the molecular formula C15H20F3N5O4S2 and a molecular weight of 455.48 g/mol. Its IUPAC name is N-[2-[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827744 |
| Molecular Formula | C15H20F3N5O4S2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[2-[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NCCC1CN(Cc2nccs2)Cc2cncn21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N5O2S2.C2HF3O2/c1-22(19,20)16-3-2-11-7-17(9-13-15-4-5-21-13)8-12-6-14-10-18(11)12;3-2(4,5)1(6)7/h4-6,10-11,16H,2-3,7-9H2,1H3;(H,6,7) |
| InChIKey | IDLOOKXXTQLRGI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |