C18H26F3N5O4 — CID 155827825
(4aR,7aS)-6-(2-methoxyethyl)-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155827825) has the molecular formula C18H26F3N5O4 and a molecular weight of 433.43 g/mol. Its IUPAC name is (4aR,7aS)-6-(2-methoxyethyl)-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4aR,7aS)-6-(2-methoxyethyl)-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827825 |
| Molecular Formula | C18H26F3N5O4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (4aR,7aS)-6-(2-methoxyethyl)-N-methyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@@]12CCCN(c3ncccn3)[C@@H]1CN(CCOC)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N5O2.C2HF3O2/c1-17-14(22)16-5-3-8-21(15-18-6-4-7-19-15)13(16)11-20(12-16)9-10-23-2;3-2(4,5)1(6)7/h4,6-7,13H,3,5,8-12H2,1-2H3,(H,17,22);(H,6,7)/t13-,16-;/m1./s1 |
| InChIKey | AFTNWQLLNRDPAP-OALZAMAHSA-N |
| XLogP | 0.77 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |