C21H23F6N5O7S — CID 155827973
N,N-dimethyl-1'-[(5-nitrothiophen-2-yl)methyl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827973) has the molecular formula C21H23F6N5O7S and a molecular weight of 603.50 g/mol. Its IUPAC name is N,N-dimethyl-1'-[(5-nitrothiophen-2-yl)methyl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-1'-[(5-nitrothiophen-2-yl)methyl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827973 |
| Molecular Formula | C21H23F6N5O7S |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | N,N-dimethyl-1'-[(5-nitrothiophen-2-yl)methyl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)c1ncc2c(n1)C1(CCN(Cc3ccc([N+](=O)[O-])s3)C1)COC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N5O3S.2C2HF3O2/c1-20(2)16-18-7-12-9-25-11-17(15(12)19-16)5-6-21(10-17)8-13-3-4-14(26-13)22(23)24;2*3-2(4,5)1(6)7/h3-4,7H,5-6,8-11H2,1-2H3;2*(H,6,7) |
| InChIKey | QCMYFCUIQMQXEG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|