C18H32F3N3O5 — CID 155828027
4a-[2-(dimethylamino)ethoxymethyl]-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828027) has the molecular formula C18H32F3N3O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4a-[2-(dimethylamino)ethoxymethyl]-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-[2-(dimethylamino)ethoxymethyl]-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828027 |
| Molecular Formula | C18H32F3N3O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 4a-[2-(dimethylamino)ethoxymethyl]-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCOCC12CCCOC1CCN(C(=O)N(C)C)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H31N3O3.C2HF3O2/c1-17(2)9-11-21-13-16-7-5-10-22-14(16)6-8-19(12-16)15(20)18(3)4;3-2(4,5)1(6)7/h14H,5-13H2,1-4H3;(H,6,7) |
| InChIKey | DDNQAXMCDAOVEN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|