C21H24F6N4O5S — CID 155828204
N-[[(1R,3aR,7aR)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828204) has the molecular formula C21H24F6N4O5S and a molecular weight of 558.50 g/mol. Its IUPAC name is N-[[(1R,3aR,7aR)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(1R,3aR,7aR)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828204 |
| Molecular Formula | C21H24F6N4O5S |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | N-[[(1R,3aR,7aR)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(NC[C@@H]2OC[C@H]3CN(Cc4cccs4)CC[C@H]32)nc1 |
| InChI | InChI=1S/C17H22N4OS.2C2HF3O2/c1-3-14(23-8-1)11-21-7-4-15-13(10-21)12-22-16(15)9-20-17-18-5-2-6-19-17;2*3-2(4,5)1(6)7/h1-3,5-6,8,13,15-16H,4,7,9-12H2,(H,18,19,20);2*(H,6,7)/t13-,15-,16+;;/m1../s1 |
| InChIKey | NZEMXLNGCCPSCM-PQQLNXCUSA-N |
| XLogP | 3.75 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |