C18H25F3N4O6 — CID 155828367
1'-(2-methoxyacetyl)-N,N-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828367) has the molecular formula C18H25F3N4O6 and a molecular weight of 450.41 g/mol. Its IUPAC name is 1'-(2-methoxyacetyl)-N,N-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-(2-methoxyacetyl)-N,N-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828367 |
| Molecular Formula | C18H25F3N4O6 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1'-(2-methoxyacetyl)-N,N-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N1CCC2(CC1)OC(C(=O)N(C)C)Cn1ccnc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O4.C2HF3O2/c1-18(2)14(22)12-10-20-9-6-17-15(20)16(24-12)4-7-19(8-5-16)13(21)11-23-3;3-2(4,5)1(6)7/h6,9,12H,4-5,7-8,10-11H2,1-3H3;(H,6,7) |
| InChIKey | WEKQIGQWXYHRBO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |