C16H23F3N4O4 — CID 155828715
(3aR,5R,7aR)-N-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828715) has the molecular formula C16H23F3N4O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828715 |
| Molecular Formula | C16H23F3N4O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (3aR,5R,7aR)-N-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2cnn(C)c2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O2.C2HF3O2/c1-15-14(19)13-4-3-11-12(20-13)5-6-18(11)9-10-7-16-17(2)8-10;3-2(4,5)1(6)7/h7-8,11-13H,3-6,9H2,1-2H3,(H,15,19);(H,6,7)/t11-,12-,13-;/m1./s1 |
| InChIKey | KECRZGZOECCPPM-NLPVPVDASA-N |
| XLogP | 0.92 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |