C22H29F6N3O6S — CID 155828724
ethyl (3aR,8aR)-2-prop-2-enyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828724) has the molecular formula C22H29F6N3O6S and a molecular weight of 577.54 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-prop-2-enyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3aR,8aR)-2-prop-2-enyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828724 |
| Molecular Formula | C22H29F6N3O6S |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | ethyl (3aR,8aR)-2-prop-2-enyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1C[C@@H]2CN(Cc3nccs3)CCC[C@]2(C(=O)OCC)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O2S.2C2HF3O2/c1-3-8-21-12-15-11-20(13-16-19-7-10-24-16)9-5-6-18(15,14-21)17(22)23-4-2;2*3-2(4,5)1(6)7/h3,7,10,15H,1,4-6,8-9,11-14H2,2H3;2*(H,6,7)/t15-,18-;;/m0../s1 |
| InChIKey | KOSZQYGARFIJIV-WQPBPYDNSA-N |
| XLogP | 3.67 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|