C18H24F6N4O6 — CID 155828895
(3aR,7aR)-N-methyl-5-[(1-methylpyrazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828895) has the molecular formula C18H24F6N4O6 and a molecular weight of 506.40 g/mol. Its IUPAC name is (3aR,7aR)-N-methyl-5-[(1-methylpyrazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,7aR)-N-methyl-5-[(1-methylpyrazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828895 |
| Molecular Formula | C18H24F6N4O6 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (3aR,7aR)-N-methyl-5-[(1-methylpyrazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CNC(=O)[C@@]12CCO[C@@H]1CCN(Cc1cnn(C)c1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O2.2C2HF3O2/c1-15-13(19)14-4-6-20-12(14)3-5-18(10-14)9-11-7-16-17(2)8-11;2*3-2(4,5)1(6)7/h7-8,12H,3-6,9-10H2,1-2H3,(H,15,19);2*(H,6,7)/t12-,14-;;/m1../s1 |
| InChIKey | WPQDHUUHPPQWIV-OJNIYTAOSA-N |
| XLogP | 1.41 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |