C18H26F3N3O4S — CID 155828902
(2R,3aS,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propan-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828902) has the molecular formula C18H26F3N3O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is (2R,3aS,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propan-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propan-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828902 |
| Molecular Formula | C18H26F3N3O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (2R,3aS,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propan-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CC[C@H]3C[C@H](C(=O)NC(C)C)O[C@H]3C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O2S.C2HF3O2/c1-10(2)17-16(20)14-6-12-4-5-19(8-15(12)21-14)7-13-9-22-11(3)18-13;3-2(4,5)1(6)7/h9-10,12,14-15H,4-8H2,1-3H3,(H,17,20);(H,6,7)/t12-,14+,15-;/m0./s1 |
| InChIKey | BGYANXDCJHMQOE-DWGNNRDYSA-N |
| XLogP | 2.59 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |