C17H16F4N4O3S — CID 155828970
[(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155828970) has the molecular formula C17H16F4N4O3S and a molecular weight of 432.40 g/mol. Its IUPAC name is [(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828970 |
| Molecular Formula | C17H16F4N4O3S |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1C[C@@H]2CN(c3ncc(F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H15FN4OS.C2HF3O2/c16-13-3-17-15(18-4-13)20-7-11-5-19(6-12(11)8-20)14(21)10-1-2-22-9-10;3-2(4,5)1(6)7/h1-4,9,11-12H,5-8H2;(H,6,7)/t11-,12+; |
| InChIKey | NDYHAXBYUDLHSM-IWKKHLOMSA-N |
| XLogP | 2.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |