C19H22F6N4O5S — CID 155829002
1-[2-(cyclopropylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155829002) has the molecular formula C19H22F6N4O5S and a molecular weight of 532.46 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[2-(cyclopropylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829002 |
| Molecular Formula | C19H22F6N4O5S |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 1-[2-(cyclopropylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CNCC2OCCc3cn(CC4CC4)nc32)n1 |
| InChI | InChI=1S/C15H20N4OS.2C2HF3O2/c1-2-11(1)9-19-10-12-3-5-20-13(15(12)18-19)7-16-8-14-17-4-6-21-14;2*3-2(4,5)1(6)7/h4,6,10-11,13,16H,1-3,5,7-9H2;2*(H,6,7) |
| InChIKey | QURMFDSVFQLKFJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |