C23H24F9N3O6S — CID 155829161
5-(pyridin-2-ylmethyl)-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;tris(2,2,2-trifluoroacetic acid) (PubChem CID 155829161) has the molecular formula C23H24F9N3O6S and a molecular weight of 641.51 g/mol. Its IUPAC name is 5-(pyridin-2-ylmethyl)-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;tris(2,2,2-trifluoroacetic acid).
| Compound Name | 5-(pyridin-2-ylmethyl)-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829161 |
| Molecular Formula | C23H24F9N3O6S |
| Molecular Weight | 641.51 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | 5-(pyridin-2-ylmethyl)-2-(thiophen-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;tris(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CN2CC3CN(Cc4ccsc4)CC3C2)nc1 |
| InChI | InChI=1S/C17H21N3S.3C2HF3O2/c1-2-5-18-17(3-1)12-20-10-15-8-19(9-16(15)11-20)7-14-4-6-21-13-14;3*3-2(4,5)1(6)7/h1-6,13,15-16H,7-12H2;3*(H,6,7) |
| InChIKey | UEIVMNJWWSKHKK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |