C19H31F3N2O5 — CID 155829294
2-[[6-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155829294) has the molecular formula C19H31F3N2O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[[6-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[6-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829294 |
| Molecular Formula | C19H31F3N2O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[[6-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COCC12CCCOC1CCN(CC1CC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H30N2O3.C2HF3O2/c1-18(2)16(20)11-21-13-17-7-3-9-22-15(17)6-8-19(12-17)10-14-4-5-14;3-2(4,5)1(6)7/h14-15H,3-13H2,1-2H3;(H,6,7) |
| InChIKey | HAXHBXPEQMKOQV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |