C19H21F3N4O4 — CID 155829397
[(3aR,7aS)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155829397) has the molecular formula C19H21F3N4O4 and a molecular weight of 426.40 g/mol. Its IUPAC name is [(3aR,7aS)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7aS)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829397 |
| Molecular Formula | C19H21F3N4O4 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [(3aR,7aS)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cnccn1)N1CC[C@@H]2CN(Cc3ccco3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H20N4O2.C2HF3O2/c22-17(16-8-18-4-5-19-16)21-6-3-13-9-20(10-14(13)11-21)12-15-2-1-7-23-15;3-2(4,5)1(6)7/h1-2,4-5,7-8,13-14H,3,6,9-12H2;(H,6,7)/t13-,14-;/m1./s1 |
| InChIKey | KTPBRKGAQHNNLQ-DTPOWOMPSA-N |
| XLogP | 2.30 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |