C21H34F3NO5 — CID 155829398
4a-(cyclopropylmethoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155829398) has the molecular formula C21H34F3NO5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4a-(cyclopropylmethoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(cyclopropylmethoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829398 |
| Molecular Formula | C21H34F3NO5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 4a-(cyclopropylmethoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | C1COC2CCN(CC3CCOCC3)CC2(COCC2CC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H33NO3.C2HF3O2/c1-7-19(15-22-13-17-2-3-17)14-20(8-4-18(19)23-9-1)12-16-5-10-21-11-6-16;3-2(4,5)1(6)7/h16-18H,1-15H2;(H,6,7) |
| InChIKey | XRIQXBMATDNPLV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |