C17H22F3N3O4S — CID 155829508
(3aR,6S,7aR)-N-cyclopropyl-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829508) has the molecular formula C17H22F3N3O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is (3aR,6S,7aR)-N-cyclopropyl-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6S,7aR)-N-cyclopropyl-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829508 |
| Molecular Formula | C17H22F3N3O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (3aR,6S,7aR)-N-cyclopropyl-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC1CC1)[C@H]1C[C@H]2OCC[C@H]2N(Cc2nccs2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21N3O2S.C2HF3O2/c19-15(17-11-1-2-11)10-7-13-12(3-5-20-13)18(8-10)9-14-16-4-6-21-14;3-2(4,5)1(6)7/h4,6,10-13H,1-3,5,7-9H2,(H,17,19);(H,6,7)/t10-,12+,13+;/m0./s1 |
| InChIKey | GXWPIJRRZJJGSQ-JJZGMWGRSA-N |
| XLogP | 2.03 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |