C20H30F3N5O5 — CID 155829528
6-N,6-N-diethyl-1-N',1-N'-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829528) has the molecular formula C20H30F3N5O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is 6-N,6-N-diethyl-1-N',1-N'-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-N,6-N-diethyl-1-N',1-N'-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829528 |
| Molecular Formula | C20H30F3N5O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 6-N,6-N-diethyl-1-N',1-N'-dimethylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)C(=O)C1Cn2ccnc2C2(CCN(C(=O)N(C)C)CC2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H29N5O3.C2HF3O2/c1-5-21(6-2)15(24)14-13-23-12-9-19-16(23)18(26-14)7-10-22(11-8-18)17(25)20(3)4;3-2(4,5)1(6)7/h9,12,14H,5-8,10-11,13H2,1-4H3;(H,6,7) |
| InChIKey | GWHHYEBWUVLNPI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |