C18H19F6N5O4S — CID 155829715
2-[[(3aS,6aR)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155829715) has the molecular formula C18H19F6N5O4S and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[(3aS,6aR)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829715 |
| Molecular Formula | C18H19F6N5O4S |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 2-[[(3aS,6aR)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(N2CC[C@@H]3[C@@H]2CCN3Cc2nccs2)nc1 |
| InChI | InChI=1S/C14H17N5S.2C2HF3O2/c1-4-16-14(17-5-1)19-8-3-11-12(19)2-7-18(11)10-13-15-6-9-20-13;2*3-2(4,5)1(6)7/h1,4-6,9,11-12H,2-3,7-8,10H2;2*(H,6,7)/t11-,12+;;/m1../s1 |
| InChIKey | ZHZURDJCQWBDEJ-QBKBNCOFSA-N |
| XLogP | 3.05 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |