C20H28F6N4O5 — CID 155829889
7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155829889) has the molecular formula C20H28F6N4O5 and a molecular weight of 518.46 g/mol. Its IUPAC name is 7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829889 |
| Molecular Formula | C20H28F6N4O5 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CCN3CC(OCC4CC4)CC3C2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O.2C2HF3O2/c1-18-8-14(7-17-18)9-19-4-5-20-11-16(6-15(20)10-19)21-12-13-2-3-13;2*3-2(4,5)1(6)7/h7-8,13,15-16H,2-6,9-12H2,1H3;2*(H,6,7) |
| InChIKey | CBOIQCQWIXLWFJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |