C19H28F3N5O4S — CID 155829955
2-ethyl-N,N-dimethyl-3-oxo-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829955) has the molecular formula C19H28F3N5O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethyl-3-oxo-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-ethyl-N,N-dimethyl-3-oxo-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829955 |
| Molecular Formula | C19H28F3N5O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-ethyl-N,N-dimethyl-3-oxo-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CC2(CC1=O)CN(Cc1nccs1)CCN(C(=O)N(C)C)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N5O2S.C2HF3O2/c1-4-21-12-17(9-15(21)23)11-20(10-14-18-5-8-25-14)6-7-22(13-17)16(24)19(2)3;3-2(4,5)1(6)7/h5,8H,4,6-7,9-13H2,1-3H3;(H,6,7) |
| InChIKey | WYKLRMUBFACCCF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |