C18H25F3N2O5 — CID 155830170
(3aS,6aR)-3a-(cyclopropylmethoxymethyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155830170) has the molecular formula C18H25F3N2O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (3aS,6aR)-3a-(cyclopropylmethoxymethyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-3a-(cyclopropylmethoxymethyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830170 |
| Molecular Formula | C18H25F3N2O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (3aS,6aR)-3a-(cyclopropylmethoxymethyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(CN2C[C@@H]3COC[C@]3(COCC3CC3)C2)no1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O3.C2HF3O2/c1-12-4-15(17-21-12)6-18-5-14-8-20-11-16(14,9-18)10-19-7-13-2-3-13;3-2(4,5)1(6)7/h4,13-14H,2-3,5-11H2,1H3;(H,6,7)/t14-,16-;/m1./s1 |
| InChIKey | XJNKRZIJHJXGQD-VNYZMKMESA-N |
| XLogP | 2.49 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |