C23H25F6N3O7 — CID 155830440
[(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyridin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830440) has the molecular formula C23H25F6N3O7 and a molecular weight of 569.46 g/mol. Its IUPAC name is [(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyridin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyridin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830440 |
| Molecular Formula | C23H25F6N3O7 |
| Molecular Weight | 569.46 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | [(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyridin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CO[C@@H]1CCN(C(=O)c2ccccn2)[C@@H]2CN(Cc3ccco3)C[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3O3.2C2HF3O2/c1-24-18-7-9-22(19(23)16-6-2-3-8-20-16)17-13-21(12-15(17)18)11-14-5-4-10-25-14;2*3-2(4,5)1(6)7/h2-6,8,10,15,17-18H,7,9,11-13H2,1H3;2*(H,6,7)/t15-,17+,18+;;/m0../s1 |
| InChIKey | HNLSQGZYPSDYAS-AZVNSBTFSA-N |
| XLogP | 3.30 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |