C24H20F6N2O6S2 — CID 155830603
2-(pyridin-4-ylmethyl)-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830603) has the molecular formula C24H20F6N2O6S2 and a molecular weight of 610.55 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethyl)-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(pyridin-4-ylmethyl)-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830603 |
| Molecular Formula | C24H20F6N2O6S2 |
| Molecular Weight | 610.55 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | 2-(pyridin-4-ylmethyl)-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=S1(=O)c2ccc(-c3ccsc3)cc2C2CN(Cc3ccncc3)CC21 |
| InChI | InChI=1S/C20H18N2O2S2.2C2HF3O2/c23-26(24)19-2-1-15(16-5-8-25-13-16)9-17(19)18-11-22(12-20(18)26)10-14-3-6-21-7-4-14;2*3-2(4,5)1(6)7/h1-9,13,18,20H,10-12H2;2*(H,6,7) |
| InChIKey | WXGYBZAUMOZHNV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |