C19H27F6N3O6 — CID 155830909
(3aS,5S,7aS)-5-(ethoxymethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830909) has the molecular formula C19H27F6N3O6 and a molecular weight of 507.43 g/mol. Its IUPAC name is (3aS,5S,7aS)-5-(ethoxymethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,5S,7aS)-5-(ethoxymethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830909 |
| Molecular Formula | C19H27F6N3O6 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (3aS,5S,7aS)-5-(ethoxymethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC[C@@H]1CC[C@H]2[C@H](CCN2Cc2cnn(C)c2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O2.2C2HF3O2/c1-3-19-11-13-4-5-14-15(20-13)6-7-18(14)10-12-8-16-17(2)9-12;2*3-2(4,5)1(6)7/h8-9,13-15H,3-7,10-11H2,1-2H3;2*(H,6,7)/t13-,14-,15-;;/m0../s1 |
| InChIKey | LCTZTZRBEVWYDB-VZXRKJOKSA-N |
| XLogP | 2.85 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |