C17H24F3N3O4S — CID 155830939
2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-propan-2-ylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155830939) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-propan-2-ylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-propan-2-ylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830939 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-propan-2-ylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)NC(=O)C[C@H]1C[C@H]2CN(Cc3nccs3)C[C@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O2S.C2HF3O2/c1-10(2)17-14(19)6-12-5-11-7-18(8-13(11)20-12)9-15-16-3-4-21-15;3-2(4,5)1(6)7/h3-4,10-13H,5-9H2,1-2H3,(H,17,19);(H,6,7)/t11-,12+,13+;/m0./s1 |
| InChIKey | PGBHHYJBRUBQRF-LUHWTZLKSA-N |
| XLogP | 2.28 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |