C22H21F4N3O3S — CID 155831085
3-(4-fluorophenyl)-1'-(thiophen-3-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid (PubChem CID 155831085) has the molecular formula C22H21F4N3O3S and a molecular weight of 483.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1'-(thiophen-3-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-fluorophenyl)-1'-(thiophen-3-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831085 |
| Molecular Formula | C22H21F4N3O3S |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 3-(4-fluorophenyl)-1'-(thiophen-3-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
| SMILES | Fc1ccc(-c2cnc3n2CC2(CCN(Cc4ccsc4)C2)OC3)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H20FN3OS.C2HF3O2/c21-17-3-1-16(2-4-17)18-9-22-19-11-25-20(14-24(18)19)6-7-23(13-20)10-15-5-8-26-12-15;3-2(4,5)1(6)7/h1-5,8-9,12H,6-7,10-11,13-14H2;(H,6,7) |
| InChIKey | HNXIZACONBXWAE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |