C17H26F3N3O5S2 — CID 155831327
4-[[(4R,4aS,7aS)-1-ethylsulfonyl-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 155831327) has the molecular formula C17H26F3N3O5S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 4-[[(4R,4aS,7aS)-1-ethylsulfonyl-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(4R,4aS,7aS)-1-ethylsulfonyl-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831327 |
| Molecular Formula | C17H26F3N3O5S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 4-[[(4R,4aS,7aS)-1-ethylsulfonyl-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1CC[C@@H](OC)[C@H]2CN(Cc3csc(C)n3)C[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O3S2.C2HF3O2/c1-4-23(19,20)18-6-5-15(21-3)13-8-17(9-14(13)18)7-12-10-22-11(2)16-12;3-2(4,5)1(6)7/h10,13-15H,4-9H2,1-3H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | YBDOXRPOIFHKKN-ONAKXNSWSA-N |
| XLogP | 1.96 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |