C21H29F3N2O5S — CID 155831372
(4R,4aS,7aS)-6-(3-methylbutyl)-1,1-dioxo-N-phenyl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155831372) has the molecular formula C21H29F3N2O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is (4R,4aS,7aS)-6-(3-methylbutyl)-1,1-dioxo-N-phenyl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aS,7aS)-6-(3-methylbutyl)-1,1-dioxo-N-phenyl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831372 |
| Molecular Formula | C21H29F3N2O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (4R,4aS,7aS)-6-(3-methylbutyl)-1,1-dioxo-N-phenyl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CCN1C[C@H]2[C@@H](C1)S(=O)(=O)CC[C@H]2C(=O)Nc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N2O3S.C2HF3O2/c1-14(2)8-10-21-12-17-16(9-11-25(23,24)18(17)13-21)19(22)20-15-6-4-3-5-7-15;3-2(4,5)1(6)7/h3-7,14,16-18H,8-13H2,1-2H3,(H,20,22);(H,6,7)/t16-,17-,18-;/m1./s1 |
| InChIKey | PGFICOQWTIYKTF-IIUXMCBISA-N |
| XLogP | 3.04 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |