C20H23F3N2O5S — CID 155831452
[(2S,3S)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155831452) has the molecular formula C20H23F3N2O5S and a molecular weight of 460.47 g/mol. Its IUPAC name is [(2S,3S)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,3S)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831452 |
| Molecular Formula | C20H23F3N2O5S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [(2S,3S)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCO[C@H]1CCN(C(=O)c2cccs2)[C@H]1Cc1cccnc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O3S.C2HF3O2/c1-22-9-10-23-16-6-8-20(18(21)17-5-3-11-24-17)15(16)12-14-4-2-7-19-13-14;3-2(4,5)1(6)7/h2-5,7,11,13,15-16H,6,8-10,12H2,1H3;(H,6,7)/t15-,16-;/m0./s1 |
| InChIKey | ZPFKYYJDQBROHJ-MOGJOVFKSA-N |
| XLogP | 3.27 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|