C20H29F6N7O5 — CID 155831583
N,N-dimethyl-2-[[5-[(1-methylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155831583) has the molecular formula C20H29F6N7O5 and a molecular weight of 561.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[5-[(1-methylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[[5-[(1-methylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155831583 |
| Molecular Formula | C20H29F6N7O5 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | N,N-dimethyl-2-[[5-[(1-methylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCOCc1nnn2c1CN(Cc1cnn(C)c1)CCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H27N7O.2C2HF3O2/c1-20(2)7-8-24-13-15-16-12-22(5-4-6-23(16)19-18-15)11-14-9-17-21(3)10-14;2*3-2(4,5)1(6)7/h9-10H,4-8,11-13H2,1-3H3;2*(H,6,7) |
| InChIKey | SEMAWKLMQMELDB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|