C19H29F3N4O4 — CID 155831755
2-[(7-cyclopentyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155831755) has the molecular formula C19H29F3N4O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-[(7-cyclopentyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(7-cyclopentyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831755 |
| Molecular Formula | C19H29F3N4O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[(7-cyclopentyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1c2ncc(COCC(=O)N(C)C)n2CCN1C1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N4O2.C2HF3O2/c1-13-17-18-10-15(11-23-12-16(22)19(2)3)21(17)9-8-20(13)14-6-4-5-7-14;3-2(4,5)1(6)7/h10,13-14H,4-9,11-12H2,1-3H3;(H,6,7) |
| InChIKey | KACDUXKBTGDTQY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |