C19H27F6N3O6S — CID 155831769
N,N-dimethyl-1-[7-(1,3-thiazol-2-ylmethyl)-1,10-dioxa-7-azaspiro[4.6]undecan-3-yl]methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155831769) has the molecular formula C19H27F6N3O6S and a molecular weight of 539.50 g/mol. Its IUPAC name is N,N-dimethyl-1-[7-(1,3-thiazol-2-ylmethyl)-1,10-dioxa-7-azaspiro[4.6]undecan-3-yl]methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-1-[7-(1,3-thiazol-2-ylmethyl)-1,10-dioxa-7-azaspiro[4.6]undecan-3-yl]methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155831769 |
| Molecular Formula | C19H27F6N3O6S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N,N-dimethyl-1-[7-(1,3-thiazol-2-ylmethyl)-1,10-dioxa-7-azaspiro[4.6]undecan-3-yl]methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CC1COC2(COCCN(Cc3nccs3)C2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O2S.2C2HF3O2/c1-17(2)8-13-7-15(20-10-13)11-18(4-5-19-12-15)9-14-16-3-6-21-14;2*3-2(4,5)1(6)7/h3,6,13H,4-5,7-12H2,1-2H3;2*(H,6,7) |
| InChIKey | IWHXGCWIRWUAIF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |