C17H23F3N2O6S — CID 155831838
(3aR,6aR)-5-ethylsulfonyl-3a-(pyridin-2-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155831838) has the molecular formula C17H23F3N2O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is (3aR,6aR)-5-ethylsulfonyl-3a-(pyridin-2-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aR)-5-ethylsulfonyl-3a-(pyridin-2-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831838 |
| Molecular Formula | C17H23F3N2O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (3aR,6aR)-5-ethylsulfonyl-3a-(pyridin-2-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1C[C@@H]2COC[C@]2(COCc2ccccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O4S.C2HF3O2/c1-2-22(18,19)17-7-13-8-20-11-15(13,10-17)12-21-9-14-5-3-4-6-16-14;3-2(4,5)1(6)7/h3-6,13H,2,7-12H2,1H3;(H,6,7)/t13-,15+;/m1./s1 |
| InChIKey | HIECDALXMVCSIT-PBCQUBLHSA-N |
| XLogP | 1.53 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |